C29H39ClN2O4 — CID 18722
2-[(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-1-yl)methyl]-3-ethyl-9,10-dimethoxy-4,6,7,11b-tetrahydro-1H-benzo[a]quinolizine chloride (PubChem CID 18722) has the molecular formula C29H39ClN2O4 and a molecular weight of 515.09 g/mol. Its IUPAC name is 2-[(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-1-yl)methyl]-3-ethyl-9,10-dimethoxy-4,6,7,11b-tetrahydro-1H-benzo[a]quinolizine chloride.
| Compound Name | 2-[(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-1-yl)methyl]-3-ethyl-9,10-dimethoxy-4,6,7,11b-tetrahydro-1H-benzo[a]quinolizine chloride |
|---|---|
| PubChem CID | 18722 |
| Molecular Formula | C29H39ClN2O4 |
| Molecular Weight | 515.09 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | 2-[(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-1-yl)methyl]-3-ethyl-9,10-dimethoxy-4,6,7,11b-tetrahydro-1H-benzo[a]quinolizine chloride |
| SMILES | CCC1=C(CC2[NH2+]CCc3cc(OC)c(OC)cc32)CC2c3cc(OC)c(OC)cc3CCN2C1.[Cl-] |
| InChI | InChI=1S/C29H38N2O4.ClH/c1-6-18-17-31-10-8-20-14-27(33-3)29(35-5)16-23(20)25(31)12-21(18)11-24-22-15-28(34-4)26(32-2)13-19(22)7-9-30-24;/h13-16,24-25,30H,6-12,17H2,1-5H3;1H |
| InChIKey | DHRVPMDKONQKAP-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 56.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.09 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|