C22H26F3N3O5S — CID 18723037
N-hydroxy-2-(pyridin-2-ylmethyl)-2-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfonylbutanamide (PubChem CID 18723037) has the molecular formula C22H26F3N3O5S and a molecular weight of 501.53 g/mol. Its IUPAC name is N-hydroxy-2-(pyridin-2-ylmethyl)-2-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfonylbutanamide.
| Compound Name | N-hydroxy-2-(pyridin-2-ylmethyl)-2-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfonylbutanamide |
|---|---|
| PubChem CID | 18723037 |
| Molecular Formula | C22H26F3N3O5S |
| Molecular Weight | 501.53 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | N-hydroxy-2-(pyridin-2-ylmethyl)-2-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfonylbutanamide |
| SMILES | CCC(Cc1ccccn1)(C(=O)NO)S(=O)(=O)N1CCC(Oc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C22H26F3N3O5S/c1-2-21(20(29)27-30,15-17-5-3-4-12-26-17)34(31,32)28-13-10-19(11-14-28)33-18-8-6-16(7-9-18)22(23,24)25/h3-9,12,19,30H,2,10-11,13-15H2,1H3,(H,27,29) |
| InChIKey | ONPPKORTYQDKKE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.53 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|