C6H11N3 — CID 18723592
1,4,5-trimethylpyrazol-3-amine (PubChem CID 18723592) has the molecular formula C6H11N3 and a molecular weight of 125.17 g/mol. Its IUPAC name is 1,4,5-trimethylpyrazol-3-amine.
| Compound Name | 1,4,5-trimethylpyrazol-3-amine |
|---|---|
| PubChem CID | 18723592 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | 1,4,5-trimethylpyrazol-3-amine |
| SMILES | Cc1c(N)nn(C)c1C |
| InChI | InChI=1S/C6H11N3/c1-4-5(2)9(3)8-6(4)7/h1-3H3,(H2,7,8) |
| InChIKey | ULKCEZJHKKBNKG-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |