C10H16N3OP — CID 18726933
2-[(1-phosphanylpiperidin-4-yl)methyl]-1H-pyrimidin-6-one (PubChem CID 18726933) has the molecular formula C10H16N3OP and a molecular weight of 225.23 g/mol. Its IUPAC name is 2-[(1-phosphanylpiperidin-4-yl)methyl]-1H-pyrimidin-6-one.
| Compound Name | 2-[(1-phosphanylpiperidin-4-yl)methyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 18726933 |
| Molecular Formula | C10H16N3OP |
| Molecular Weight | 225.23 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 2-[(1-phosphanylpiperidin-4-yl)methyl]-1H-pyrimidin-6-one |
| SMILES | O=c1ccnc(CC2CCN(P)CC2)[nH]1 |
| InChI | InChI=1S/C10H16N3OP/c14-10-1-4-11-9(12-10)7-8-2-5-13(15)6-3-8/h1,4,8H,2-3,5-7,15H2,(H,11,12,14) |
| InChIKey | AZAQEAKYJPMTOH-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.23 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|