C14H27N3O — CID 91106069
ethane;2-(piperidin-4-ylmethyl)-1H-pyrimidin-6-one (PubChem CID 91106069) has the molecular formula C14H27N3O and a molecular weight of 253.39 g/mol. Its IUPAC name is ethane;2-(piperidin-4-ylmethyl)-1H-pyrimidin-6-one.
| Compound Name | ethane;2-(piperidin-4-ylmethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 91106069 |
| Molecular Formula | C14H27N3O |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.22 |
| IUPAC Name | ethane;2-(piperidin-4-ylmethyl)-1H-pyrimidin-6-one |
| SMILES | CC.CC.O=c1ccnc(CC2CCNCC2)[nH]1 |
| InChI | InChI=1S/C10H15N3O.2C2H6/c14-10-3-6-12-9(13-10)7-8-1-4-11-5-2-8;2*1-2/h3,6,8,11H,1-2,4-5,7H2,(H,12,13,14);2*1-2H3 |
| InChIKey | FSCKDVGAXKHKSA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |