C15H23N3O4S — CID 18727219
(2R)-1-[4-(1H-pyrrol-3-yl)piperidin-1-yl]sulfonylpiperidine-2-carboxylic acid (PubChem CID 18727219) has the molecular formula C15H23N3O4S and a molecular weight of 341.43 g/mol. Its IUPAC name is (2R)-1-[4-(1H-pyrrol-3-yl)piperidin-1-yl]sulfonylpiperidine-2-carboxylic acid.
| Compound Name | (2R)-1-[4-(1H-pyrrol-3-yl)piperidin-1-yl]sulfonylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 18727219 |
| Molecular Formula | C15H23N3O4S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (2R)-1-[4-(1H-pyrrol-3-yl)piperidin-1-yl]sulfonylpiperidine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCCN1S(=O)(=O)N1CCC(c2cc[nH]c2)CC1 |
| InChI | InChI=1S/C15H23N3O4S/c19-15(20)14-3-1-2-8-18(14)23(21,22)17-9-5-12(6-10-17)13-4-7-16-11-13/h4,7,11-12,14,16H,1-3,5-6,8-10H2,(H,19,20)/t14-/m1/s1 |
| InChIKey | ZLJYKLLZYQNZGV-CQSZACIVSA-N |
| XLogP | 1.38 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |