C12H22N2O4S — CID 28784096
(2S)-1-(4-methylpiperidin-1-yl)sulfonylpiperidine-2-carboxylic acid (PubChem CID 28784096) has the molecular formula C12H22N2O4S and a molecular weight of 290.38 g/mol. Its IUPAC name is (2S)-1-(4-methylpiperidin-1-yl)sulfonylpiperidine-2-carboxylic acid.
| Compound Name | (2S)-1-(4-methylpiperidin-1-yl)sulfonylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 28784096 |
| Molecular Formula | C12H22N2O4S |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | (2S)-1-(4-methylpiperidin-1-yl)sulfonylpiperidine-2-carboxylic acid |
| SMILES | CC1CCN(S(=O)(=O)N2CCCC[C@H]2C(=O)O)CC1 |
| InChI | InChI=1S/C12H22N2O4S/c1-10-5-8-13(9-6-10)19(17,18)14-7-3-2-4-11(14)12(15)16/h10-11H,2-9H2,1H3,(H,15,16)/t11-/m0/s1 |
| InChIKey | OIEBZFPACVBDGA-NSHDSACASA-N |
| XLogP | 0.90 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |