About N-ethyl-N-methyl-4,5-dihydro-1H-imidazol-2-amine
N-ethyl-N-methyl-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 18728206) has the molecular formula C6H13N3
and a molecular weight of 127.19 g/mol. Its IUPAC name is N-ethyl-N-methyl-4,5-dihydro-1H-imidazol-2-amine.
Analyze N-ethyl-N-methyl-4,5-dihydro-1H-imidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-methyl-4,5-dihydro-1H-imidazol-2-amine?
The IUPAC name of N-ethyl-N-methyl-4,5-dihydro-1H-imidazol-2-amine (CID 18728206) is N-ethyl-N-methyl-4,5-dihydro-1H-imidazol-2-amine.
What is the SMILES notation for N-ethyl-N-methyl-4,5-dihydro-1H-imidazol-2-amine?
The canonical SMILES for N-ethyl-N-methyl-4,5-dihydro-1H-imidazol-2-amine is CCN(C)C1=NCCN1.
What is the InChIKey of N-ethyl-N-methyl-4,5-dihydro-1H-imidazol-2-amine?
The InChIKey is WOVOBHKBAHKYFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N3/c1-3-9(2)6-7-4-5-8-6/h3-5H2,1-2H3,(H,7,8).
What are the key properties of N-ethyl-N-methyl-4,5-dihydro-1H-imidazol-2-amine?
N-ethyl-N-methyl-4,5-dihydro-1H-imidazol-2-amine has a molecular weight of 127.19 g/mol, XLogP of -0.10, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-methyl-4,5-dihydro-1H-imidazol-2-amine is sourced from PubChem (CID 18728206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).