About 1-methyl-4,5-dihydroimidazol-2-amine;hydrobromide
1-methyl-4,5-dihydroimidazol-2-amine;hydrobromide (PubChem CID 13492717) has the molecular formula C4H10BrN3
and a molecular weight of 180.05 g/mol. Its IUPAC name is 1-methyl-4,5-dihydroimidazol-2-amine;hydrobromide.
Analyze 1-methyl-4,5-dihydroimidazol-2-amine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4,5-dihydroimidazol-2-amine;hydrobromide?
The IUPAC name of 1-methyl-4,5-dihydroimidazol-2-amine;hydrobromide (CID 13492717) is 1-methyl-4,5-dihydroimidazol-2-amine;hydrobromide.
What is the SMILES notation for 1-methyl-4,5-dihydroimidazol-2-amine;hydrobromide?
The canonical SMILES for 1-methyl-4,5-dihydroimidazol-2-amine;hydrobromide is Br.CN1CCN=C1N.
What is the InChIKey of 1-methyl-4,5-dihydroimidazol-2-amine;hydrobromide?
The InChIKey is MHWCDQADKQTWOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N3.BrH/c1-7-3-2-6-4(7)5;/h2-3H2,1H3,(H2,5,6);1H.
What are the key properties of 1-methyl-4,5-dihydroimidazol-2-amine;hydrobromide?
1-methyl-4,5-dihydroimidazol-2-amine;hydrobromide has a molecular weight of 180.05 g/mol, XLogP of -0.18, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4,5-dihydroimidazol-2-amine;hydrobromide is sourced from PubChem (CID 13492717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).