C7H14N2O3 — CID 18728954
3-acetamido-2-hydroxy-N-methylbutanamide (PubChem CID 18728954) has the molecular formula C7H14N2O3 and a molecular weight of 174.20 g/mol. Its IUPAC name is 3-acetamido-2-hydroxy-N-methylbutanamide.
| Compound Name | 3-acetamido-2-hydroxy-N-methylbutanamide |
|---|---|
| PubChem CID | 18728954 |
| Molecular Formula | C7H14N2O3 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 3-acetamido-2-hydroxy-N-methylbutanamide |
| SMILES | CNC(=O)C(O)C(C)NC(C)=O |
| InChI | InChI=1S/C7H14N2O3/c1-4(9-5(2)10)6(11)7(12)8-3/h4,6,11H,1-3H3,(H,8,12)(H,9,10) |
| InChIKey | WEQKWSXLICEGRD-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |