C7H15NO2 — CID 55301756
N-[(2S,3S)-3-hydroxypentan-2-yl]acetamide (PubChem CID 55301756) has the molecular formula C7H15NO2 and a molecular weight of 145.20 g/mol. Its IUPAC name is N-[(2S,3S)-3-hydroxypentan-2-yl]acetamide.
| Compound Name | N-[(2S,3S)-3-hydroxypentan-2-yl]acetamide |
|---|---|
| PubChem CID | 55301756 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | N-[(2S,3S)-3-hydroxypentan-2-yl]acetamide |
| SMILES | CC[C@H](O)[C@H](C)NC(C)=O |
| InChI | InChI=1S/C7H15NO2/c1-4-7(10)5(2)8-6(3)9/h5,7,10H,4H2,1-3H3,(H,8,9)/t5-,7-/m0/s1 |
| InChIKey | OTDAUCSBBYTJHP-FSPLSTOPSA-N |
| XLogP | 0.28 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |