C16H29NO2 — CID 14235828
N-[(2S,3S,5E,7E)-3-hydroxytetradeca-5,7-dien-2-yl]acetamide (PubChem CID 14235828) has the molecular formula C16H29NO2 and a molecular weight of 267.41 g/mol. Its IUPAC name is N-[(2S,3S,5E,7E)-3-hydroxytetradeca-5,7-dien-2-yl]acetamide.
| Compound Name | N-[(2S,3S,5E,7E)-3-hydroxytetradeca-5,7-dien-2-yl]acetamide |
|---|---|
| PubChem CID | 14235828 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | N-[(2S,3S,5E,7E)-3-hydroxytetradeca-5,7-dien-2-yl]acetamide |
| SMILES | CCCCCC/C=C/C=C/C[C@H](O)[C@H](C)NC(C)=O |
| InChI | InChI=1S/C16H29NO2/c1-4-5-6-7-8-9-10-11-12-13-16(19)14(2)17-15(3)18/h9-12,14,16,19H,4-8,13H2,1-3H3,(H,17,18)/b10-9+,12-11+/t14-,16-/m0/s1 |
| InChIKey | BVQKCVQOUIZCRQ-RTSAYLDSSA-N |
| XLogP | 3.34 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|