C12H23NO2 — CID 54753229
N-[(E,2S,3R)-3-hydroxydec-5-en-2-yl]acetamide (PubChem CID 54753229) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is N-[(E,2S,3R)-3-hydroxydec-5-en-2-yl]acetamide.
| Compound Name | N-[(E,2S,3R)-3-hydroxydec-5-en-2-yl]acetamide |
|---|---|
| PubChem CID | 54753229 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | N-[(E,2S,3R)-3-hydroxydec-5-en-2-yl]acetamide |
| SMILES | CCCC/C=C/C[C@@H](O)[C@H](C)NC(C)=O |
| InChI | InChI=1S/C12H23NO2/c1-4-5-6-7-8-9-12(15)10(2)13-11(3)14/h7-8,10,12,15H,4-6,9H2,1-3H3,(H,13,14)/b8-7+/t10-,12+/m0/s1 |
| InChIKey | UQCCVHCEIQSNJC-PXYQHZOESA-N |
| XLogP | 2.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|