C13H22O5 — CID 95789909
(2S,3S)-3-hydroxy-2-[(Z)-oct-2-enyl]pentanedioic acid (PubChem CID 95789909) has the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. Its IUPAC name is (2S,3S)-3-hydroxy-2-[(Z)-oct-2-enyl]pentanedioic acid.
| Compound Name | (2S,3S)-3-hydroxy-2-[(Z)-oct-2-enyl]pentanedioic acid |
|---|---|
| PubChem CID | 95789909 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | (2S,3S)-3-hydroxy-2-[(Z)-oct-2-enyl]pentanedioic acid |
| SMILES | CCCCC/C=C\CC(C(=O)O)[C@@H](O)CC(=O)O |
| InChI | InChI=1S/C13H22O5/c1-2-3-4-5-6-7-8-10(13(17)18)11(14)9-12(15)16/h6-7,10-11,14H,2-5,8-9H2,1H3,(H,15,16)(H,17,18)/b7-6-/t10?,11-/m0/s1 |
| InChIKey | XULHQOQSIFECQQ-HCBMSMOGSA-N |
| XLogP | 2.05 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|