C25H38AcO4 — CID 18729279
actinium;17-ethyl-10,13-dimethyl-17-(2-methyl-1,3-dioxolan-2-yl)-1,2,3,4,7,8,9,11,12,16-decahydrocyclopenta[a]phenanthrene-3,12-diol (PubChem CID 18729279) has the molecular formula C25H38AcO4 and a molecular weight of 629.58 g/mol. Its IUPAC name is actinium;17-ethyl-10,13-dimethyl-17-(2-methyl-1,3-dioxolan-2-yl)-1,2,3,4,7,8,9,11,12,16-decahydrocyclopenta[a]phenanthrene-3,12-diol.
| Compound Name | actinium;17-ethyl-10,13-dimethyl-17-(2-methyl-1,3-dioxolan-2-yl)-1,2,3,4,7,8,9,11,12,16-decahydrocyclopenta[a]phenanthrene-3,12-diol |
|---|---|
| PubChem CID | 18729279 |
| Molecular Formula | C25H38AcO4 |
| Molecular Weight | 629.58 g/mol |
| Exact Mass | 629.30 |
| IUPAC Name | actinium;17-ethyl-10,13-dimethyl-17-(2-methyl-1,3-dioxolan-2-yl)-1,2,3,4,7,8,9,11,12,16-decahydrocyclopenta[a]phenanthrene-3,12-diol |
| SMILES | CCC1(C2(C)OCCO2)CC=C2C3CC=C4CC(O)CCC4(C)C3CC(O)C21C.[Ac] |
| InChI | InChI=1S/C25H38O4.Ac/c1-5-25(24(4)28-12-13-29-24)11-9-19-18-7-6-16-14-17(26)8-10-22(16,2)20(18)15-21(27)23(19,25)3;/h6,9,17-18,20-21,26-27H,5,7-8,10-15H2,1-4H3; |
| InChIKey | XGOWIPFMBCWAEK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.58 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|