C16H28N2O5 — CID 18730702
(E)-4-[2-[butyl(6-hydroxyhexanoyl)amino]ethylamino]-4-oxobut-2-enoic acid (PubChem CID 18730702) has the molecular formula C16H28N2O5 and a molecular weight of 328.41 g/mol. Its IUPAC name is (E)-4-[2-[butyl(6-hydroxyhexanoyl)amino]ethylamino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[2-[butyl(6-hydroxyhexanoyl)amino]ethylamino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 18730702 |
| Molecular Formula | C16H28N2O5 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | (E)-4-[2-[butyl(6-hydroxyhexanoyl)amino]ethylamino]-4-oxobut-2-enoic acid |
| SMILES | CCCCN(CCNC(=O)/C=C/C(=O)O)C(=O)CCCCCO |
| InChI | InChI=1S/C16H28N2O5/c1-2-3-11-18(15(21)7-5-4-6-13-19)12-10-17-14(20)8-9-16(22)23/h8-9,19H,2-7,10-13H2,1H3,(H,17,20)(H,22,23)/b9-8+ |
| InChIKey | NZBXVXWDXSTYCK-CMDGGOBGSA-N |
| XLogP | 0.92 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|