C20H30N2O8 — CID 18730700
(E)-4-[2-[butyl-[6-[(E)-3-carboxyprop-2-enoyl]oxyhexanoyl]amino]ethylamino]-4-oxobut-2-enoic acid (PubChem CID 18730700) has the molecular formula C20H30N2O8 and a molecular weight of 426.47 g/mol. Its IUPAC name is (E)-4-[2-[butyl-[6-[(E)-3-carboxyprop-2-enoyl]oxyhexanoyl]amino]ethylamino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[2-[butyl-[6-[(E)-3-carboxyprop-2-enoyl]oxyhexanoyl]amino]ethylamino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 18730700 |
| Molecular Formula | C20H30N2O8 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | (E)-4-[2-[butyl-[6-[(E)-3-carboxyprop-2-enoyl]oxyhexanoyl]amino]ethylamino]-4-oxobut-2-enoic acid |
| SMILES | CCCCN(CCNC(=O)/C=C/C(=O)O)C(=O)CCCCCOC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C20H30N2O8/c1-2-3-13-22(14-12-21-16(23)8-9-18(25)26)17(24)7-5-4-6-15-30-20(29)11-10-19(27)28/h8-11H,2-7,12-15H2,1H3,(H,21,23)(H,25,26)(H,27,28)/b9-8+,11-10+ |
| InChIKey | PNENOFIDICIVAF-BNFZFUHLSA-N |
| XLogP | 1.12 |
| TPSA | 150.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|