C26H36N2O12 — CID 18730711
(E)-4-[butyl-[2-[2-[(E)-3-carboxyprop-2-enoyl]oxyethyl-[6-[(E)-3-carboxyprop-2-enoyl]oxyhexanoyl]amino]ethyl]amino]-4-oxobut-2-enoic acid (PubChem CID 18730711) has the molecular formula C26H36N2O12 and a molecular weight of 568.58 g/mol. Its IUPAC name is (E)-4-[butyl-[2-[2-[(E)-3-carboxyprop-2-enoyl]oxyethyl-[6-[(E)-3-carboxyprop-2-enoyl]oxyhexanoyl]amino]ethyl]amino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[butyl-[2-[2-[(E)-3-carboxyprop-2-enoyl]oxyethyl-[6-[(E)-3-carboxyprop-2-enoyl]oxyhexanoyl]amino]ethyl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 18730711 |
| Molecular Formula | C26H36N2O12 |
| Molecular Weight | 568.58 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | (E)-4-[butyl-[2-[2-[(E)-3-carboxyprop-2-enoyl]oxyethyl-[6-[(E)-3-carboxyprop-2-enoyl]oxyhexanoyl]amino]ethyl]amino]-4-oxobut-2-enoic acid |
| SMILES | CCCCN(CCN(CCOC(=O)/C=C/C(=O)O)C(=O)CCCCCOC(=O)/C=C/C(=O)O)C(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C26H36N2O12/c1-2-3-14-27(21(30)8-9-22(31)32)15-16-28(17-19-40-26(38)13-11-24(35)36)20(29)7-5-4-6-18-39-25(37)12-10-23(33)34/h8-13H,2-7,14-19H2,1H3,(H,31,32)(H,33,34)(H,35,36)/b9-8+,12-10+,13-11+ |
| InChIKey | SFAGGEKIWACIOH-YIDQAKLOSA-N |
| XLogP | 1.01 |
| TPSA | 205.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.58 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|