C28H43NO12 — CID 18730718
(E)-4-[6-[2-[butyl-[2-[6-[(E)-3-carboxyprop-2-enoyl]oxyhexanoyloxy]ethyl]amino]ethoxy]-6-oxohexoxy]-4-oxobut-2-enoic acid (PubChem CID 18730718) has the molecular formula C28H43NO12 and a molecular weight of 585.65 g/mol. Its IUPAC name is (E)-4-[6-[2-[butyl-[2-[6-[(E)-3-carboxyprop-2-enoyl]oxyhexanoyloxy]ethyl]amino]ethoxy]-6-oxohexoxy]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[6-[2-[butyl-[2-[6-[(E)-3-carboxyprop-2-enoyl]oxyhexanoyloxy]ethyl]amino]ethoxy]-6-oxohexoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 18730718 |
| Molecular Formula | C28H43NO12 |
| Molecular Weight | 585.65 g/mol |
| Exact Mass | 585.28 |
| IUPAC Name | (E)-4-[6-[2-[butyl-[2-[6-[(E)-3-carboxyprop-2-enoyl]oxyhexanoyloxy]ethyl]amino]ethoxy]-6-oxohexoxy]-4-oxobut-2-enoic acid |
| SMILES | CCCCN(CCOC(=O)CCCCCOC(=O)/C=C/C(=O)O)CCOC(=O)CCCCCOC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C28H43NO12/c1-2-3-16-29(17-21-40-25(34)10-6-4-8-19-38-27(36)14-12-23(30)31)18-22-41-26(35)11-7-5-9-20-39-28(37)15-13-24(32)33/h12-15H,2-11,16-22H2,1H3,(H,30,31)(H,32,33)/b14-12+,15-13+ |
| InChIKey | RMVWZCMKOYUVDA-QUMQEAAQSA-N |
| XLogP | 2.66 |
| TPSA | 183.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.65 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|