C30H48N2O12 — CID 18730716
(E)-4-[6-[2-[2-[butyl-[2-[6-[(E)-3-carboxyprop-2-enoyl]oxyhexanoyloxy]ethyl]amino]ethylamino]ethoxy]-6-oxohexoxy]-4-oxobut-2-enoic acid (PubChem CID 18730716) has the molecular formula C30H48N2O12 and a molecular weight of 628.72 g/mol. Its IUPAC name is (E)-4-[6-[2-[2-[butyl-[2-[6-[(E)-3-carboxyprop-2-enoyl]oxyhexanoyloxy]ethyl]amino]ethylamino]ethoxy]-6-oxohexoxy]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[6-[2-[2-[butyl-[2-[6-[(E)-3-carboxyprop-2-enoyl]oxyhexanoyloxy]ethyl]amino]ethylamino]ethoxy]-6-oxohexoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 18730716 |
| Molecular Formula | C30H48N2O12 |
| Molecular Weight | 628.72 g/mol |
| Exact Mass | 628.32 |
| IUPAC Name | (E)-4-[6-[2-[2-[butyl-[2-[6-[(E)-3-carboxyprop-2-enoyl]oxyhexanoyloxy]ethyl]amino]ethylamino]ethoxy]-6-oxohexoxy]-4-oxobut-2-enoic acid |
| SMILES | CCCCN(CCNCCOC(=O)CCCCCOC(=O)/C=C/C(=O)O)CCOC(=O)CCCCCOC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C30H48N2O12/c1-2-3-18-32(20-24-44-28(38)11-7-5-9-22-42-30(40)15-13-26(35)36)19-16-31-17-23-43-27(37)10-6-4-8-21-41-29(39)14-12-25(33)34/h12-15,31H,2-11,16-24H2,1H3,(H,33,34)(H,35,36)/b14-12+,15-13+ |
| InChIKey | PQZDBPIUUJEPGR-QUMQEAAQSA-N |
| XLogP | 2.25 |
| TPSA | 195.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.72 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|