C13H26O3 — CID 18731085
2-methoxypropan-2-yl 3,3,4,4-tetramethylpentanoate (PubChem CID 18731085) has the molecular formula C13H26O3 and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-methoxypropan-2-yl 3,3,4,4-tetramethylpentanoate.
| Compound Name | 2-methoxypropan-2-yl 3,3,4,4-tetramethylpentanoate |
|---|---|
| PubChem CID | 18731085 |
| Molecular Formula | C13H26O3 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.19 |
| IUPAC Name | 2-methoxypropan-2-yl 3,3,4,4-tetramethylpentanoate |
| SMILES | COC(C)(C)OC(=O)CC(C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H26O3/c1-11(2,3)12(4,5)9-10(14)16-13(6,7)15-8/h9H2,1-8H3 |
| InChIKey | SNXMQBDOZOGYRS-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|