C20H24BrN3OS — CID 18733185
5-bromo-N-[(1-ethylbenzimidazol-2-yl)methyl]-N-(3-methylbutyl)thiophene-2-carboxamide (PubChem CID 18733185) has the molecular formula C20H24BrN3OS and a molecular weight of 434.40 g/mol. Its IUPAC name is 5-bromo-N-[(1-ethylbenzimidazol-2-yl)methyl]-N-(3-methylbutyl)thiophene-2-carboxamide.
| Compound Name | 5-bromo-N-[(1-ethylbenzimidazol-2-yl)methyl]-N-(3-methylbutyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 18733185 |
| Molecular Formula | C20H24BrN3OS |
| Molecular Weight | 434.40 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | 5-bromo-N-[(1-ethylbenzimidazol-2-yl)methyl]-N-(3-methylbutyl)thiophene-2-carboxamide |
| SMILES | CCn1c(CN(CCC(C)C)C(=O)c2ccc(Br)s2)nc2ccccc21 |
| InChI | InChI=1S/C20H24BrN3OS/c1-4-24-16-8-6-5-7-15(16)22-19(24)13-23(12-11-14(2)3)20(25)17-9-10-18(21)26-17/h5-10,14H,4,11-13H2,1-3H3 |
| InChIKey | OSOZJFAKJBPPOT-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.40 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |