C25H32ClN3O2 — CID 18733389
N-[(1-butylbenzimidazol-2-yl)methyl]-5-chloro-2-methoxy-N-(3-methylbutyl)benzamide (PubChem CID 18733389) has the molecular formula C25H32ClN3O2 and a molecular weight of 442.00 g/mol. Its IUPAC name is N-[(1-butylbenzimidazol-2-yl)methyl]-5-chloro-2-methoxy-N-(3-methylbutyl)benzamide.
| Compound Name | N-[(1-butylbenzimidazol-2-yl)methyl]-5-chloro-2-methoxy-N-(3-methylbutyl)benzamide |
|---|---|
| PubChem CID | 18733389 |
| Molecular Formula | C25H32ClN3O2 |
| Molecular Weight | 442.00 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | N-[(1-butylbenzimidazol-2-yl)methyl]-5-chloro-2-methoxy-N-(3-methylbutyl)benzamide |
| SMILES | CCCCn1c(CN(CCC(C)C)C(=O)c2cc(Cl)ccc2OC)nc2ccccc21 |
| InChI | InChI=1S/C25H32ClN3O2/c1-5-6-14-29-22-10-8-7-9-21(22)27-24(29)17-28(15-13-18(2)3)25(30)20-16-19(26)11-12-23(20)31-4/h7-12,16,18H,5-6,13-15,17H2,1-4H3 |
| InChIKey | JRLSAHQIHYHIIN-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.00 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |