C27H34ClN3O2 — CID 18733197
5-chloro-N-[(1-cyclohexylbenzimidazol-2-yl)methyl]-2-methoxy-N-(3-methylbutyl)benzamide (PubChem CID 18733197) has the molecular formula C27H34ClN3O2 and a molecular weight of 468.04 g/mol. Its IUPAC name is 5-chloro-N-[(1-cyclohexylbenzimidazol-2-yl)methyl]-2-methoxy-N-(3-methylbutyl)benzamide.
| Compound Name | 5-chloro-N-[(1-cyclohexylbenzimidazol-2-yl)methyl]-2-methoxy-N-(3-methylbutyl)benzamide |
|---|---|
| PubChem CID | 18733197 |
| Molecular Formula | C27H34ClN3O2 |
| Molecular Weight | 468.04 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | 5-chloro-N-[(1-cyclohexylbenzimidazol-2-yl)methyl]-2-methoxy-N-(3-methylbutyl)benzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)N(CCC(C)C)Cc1nc2ccccc2n1C1CCCCC1 |
| InChI | InChI=1S/C27H34ClN3O2/c1-19(2)15-16-30(27(32)22-17-20(28)13-14-25(22)33-3)18-26-29-23-11-7-8-12-24(23)31(26)21-9-5-4-6-10-21/h7-8,11-14,17,19,21H,4-6,9-10,15-16,18H2,1-3H3 |
| InChIKey | OZSUJFRAOSMPQQ-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.04 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |