C26H34N4O3 — CID 18734070
N-[(3-cyclopentylimidazo[4,5-b]pyridin-2-yl)methyl]-2,5-dimethoxy-N-pentylbenzamide (PubChem CID 18734070) has the molecular formula C26H34N4O3 and a molecular weight of 450.58 g/mol. Its IUPAC name is N-[(3-cyclopentylimidazo[4,5-b]pyridin-2-yl)methyl]-2,5-dimethoxy-N-pentylbenzamide.
| Compound Name | N-[(3-cyclopentylimidazo[4,5-b]pyridin-2-yl)methyl]-2,5-dimethoxy-N-pentylbenzamide |
|---|---|
| PubChem CID | 18734070 |
| Molecular Formula | C26H34N4O3 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | N-[(3-cyclopentylimidazo[4,5-b]pyridin-2-yl)methyl]-2,5-dimethoxy-N-pentylbenzamide |
| SMILES | CCCCCN(Cc1nc2cccnc2n1C1CCCC1)C(=O)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C26H34N4O3/c1-4-5-8-16-29(26(31)21-17-20(32-2)13-14-23(21)33-3)18-24-28-22-12-9-15-27-25(22)30(24)19-10-6-7-11-19/h9,12-15,17,19H,4-8,10-11,16,18H2,1-3H3 |
| InChIKey | SABZYRLVJMCJSW-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|