C25H32N4O — CID 18734097
N-[(3-cyclopentylimidazo[4,5-b]pyridin-2-yl)methyl]-3-methyl-N-pentylbenzamide (PubChem CID 18734097) has the molecular formula C25H32N4O and a molecular weight of 404.56 g/mol. Its IUPAC name is N-[(3-cyclopentylimidazo[4,5-b]pyridin-2-yl)methyl]-3-methyl-N-pentylbenzamide.
| Compound Name | N-[(3-cyclopentylimidazo[4,5-b]pyridin-2-yl)methyl]-3-methyl-N-pentylbenzamide |
|---|---|
| PubChem CID | 18734097 |
| Molecular Formula | C25H32N4O |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | N-[(3-cyclopentylimidazo[4,5-b]pyridin-2-yl)methyl]-3-methyl-N-pentylbenzamide |
| SMILES | CCCCCN(Cc1nc2cccnc2n1C1CCCC1)C(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C25H32N4O/c1-3-4-7-16-28(25(30)20-11-8-10-19(2)17-20)18-23-27-22-14-9-15-26-24(22)29(23)21-12-5-6-13-21/h8-11,14-15,17,21H,3-7,12-13,16,18H2,1-2H3 |
| InChIKey | GJTVDLGCRIJVBR-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|