C24H28F2N4O — CID 18734067
N-[(3-cyclopentylimidazo[4,5-b]pyridin-2-yl)methyl]-2,4-difluoro-N-pentylbenzamide (PubChem CID 18734067) has the molecular formula C24H28F2N4O and a molecular weight of 426.51 g/mol. Its IUPAC name is N-[(3-cyclopentylimidazo[4,5-b]pyridin-2-yl)methyl]-2,4-difluoro-N-pentylbenzamide.
| Compound Name | N-[(3-cyclopentylimidazo[4,5-b]pyridin-2-yl)methyl]-2,4-difluoro-N-pentylbenzamide |
|---|---|
| PubChem CID | 18734067 |
| Molecular Formula | C24H28F2N4O |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | N-[(3-cyclopentylimidazo[4,5-b]pyridin-2-yl)methyl]-2,4-difluoro-N-pentylbenzamide |
| SMILES | CCCCCN(Cc1nc2cccnc2n1C1CCCC1)C(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C24H28F2N4O/c1-2-3-6-14-29(24(31)19-12-11-17(25)15-20(19)26)16-22-28-21-10-7-13-27-23(21)30(22)18-8-4-5-9-18/h7,10-13,15,18H,2-6,8-9,14,16H2,1H3 |
| InChIKey | GJCHZOZNCKSIIL-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|