C23H27Cl2N3O — CID 18734478
N-butyl-N-[(1-butylbenzimidazol-2-yl)methyl]-2,5-dichlorobenzamide (PubChem CID 18734478) has the molecular formula C23H27Cl2N3O and a molecular weight of 432.40 g/mol. Its IUPAC name is N-butyl-N-[(1-butylbenzimidazol-2-yl)methyl]-2,5-dichlorobenzamide.
| Compound Name | N-butyl-N-[(1-butylbenzimidazol-2-yl)methyl]-2,5-dichlorobenzamide |
|---|---|
| PubChem CID | 18734478 |
| Molecular Formula | C23H27Cl2N3O |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | N-butyl-N-[(1-butylbenzimidazol-2-yl)methyl]-2,5-dichlorobenzamide |
| SMILES | CCCCN(Cc1nc2ccccc2n1CCCC)C(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C23H27Cl2N3O/c1-3-5-13-27(23(29)18-15-17(24)11-12-19(18)25)16-22-26-20-9-7-8-10-21(20)28(22)14-6-4-2/h7-12,15H,3-6,13-14,16H2,1-2H3 |
| InChIKey | KCVLHOOGPPMLIJ-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |