C22H26ClN3O — CID 18734535
N-butyl-N-[(6-chloro-1-propylbenzimidazol-2-yl)methyl]benzamide (PubChem CID 18734535) has the molecular formula C22H26ClN3O and a molecular weight of 383.92 g/mol. Its IUPAC name is N-butyl-N-[(6-chloro-1-propylbenzimidazol-2-yl)methyl]benzamide.
| Compound Name | N-butyl-N-[(6-chloro-1-propylbenzimidazol-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 18734535 |
| Molecular Formula | C22H26ClN3O |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | N-butyl-N-[(6-chloro-1-propylbenzimidazol-2-yl)methyl]benzamide |
| SMILES | CCCCN(Cc1nc2ccc(Cl)cc2n1CCC)C(=O)c1ccccc1 |
| InChI | InChI=1S/C22H26ClN3O/c1-3-5-14-25(22(27)17-9-7-6-8-10-17)16-21-24-19-12-11-18(23)15-20(19)26(21)13-4-2/h6-12,15H,3-5,13-14,16H2,1-2H3 |
| InChIKey | CJPXZBRAPCGRBO-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |