C23H26F3N3O — CID 18732577
2,5-difluoro-N-[(6-fluoro-1-propylbenzimidazol-2-yl)methyl]-N-pentylbenzamide (PubChem CID 18732577) has the molecular formula C23H26F3N3O and a molecular weight of 417.48 g/mol. Its IUPAC name is 2,5-difluoro-N-[(6-fluoro-1-propylbenzimidazol-2-yl)methyl]-N-pentylbenzamide.
| Compound Name | 2,5-difluoro-N-[(6-fluoro-1-propylbenzimidazol-2-yl)methyl]-N-pentylbenzamide |
|---|---|
| PubChem CID | 18732577 |
| Molecular Formula | C23H26F3N3O |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | 2,5-difluoro-N-[(6-fluoro-1-propylbenzimidazol-2-yl)methyl]-N-pentylbenzamide |
| SMILES | CCCCCN(Cc1nc2ccc(F)cc2n1CCC)C(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C23H26F3N3O/c1-3-5-6-12-28(23(30)18-13-16(24)7-9-19(18)26)15-22-27-20-10-8-17(25)14-21(20)29(22)11-4-2/h7-10,13-14H,3-6,11-12,15H2,1-2H3 |
| InChIKey | KWBCOMBRBRBAJD-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|