C24H30FN3O — CID 18734004
N-[(6-fluoro-1-propylbenzimidazol-2-yl)methyl]-3-methyl-N-pentylbenzamide (PubChem CID 18734004) has the molecular formula C24H30FN3O and a molecular weight of 395.52 g/mol. Its IUPAC name is N-[(6-fluoro-1-propylbenzimidazol-2-yl)methyl]-3-methyl-N-pentylbenzamide.
| Compound Name | N-[(6-fluoro-1-propylbenzimidazol-2-yl)methyl]-3-methyl-N-pentylbenzamide |
|---|---|
| PubChem CID | 18734004 |
| Molecular Formula | C24H30FN3O |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | N-[(6-fluoro-1-propylbenzimidazol-2-yl)methyl]-3-methyl-N-pentylbenzamide |
| SMILES | CCCCCN(Cc1nc2ccc(F)cc2n1CCC)C(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C24H30FN3O/c1-4-6-7-14-27(24(29)19-10-8-9-18(3)15-19)17-23-26-21-12-11-20(25)16-22(21)28(23)13-5-2/h8-12,15-16H,4-7,13-14,17H2,1-3H3 |
| InChIKey | RLHQOYYKSKWMNC-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|