C20H24FN3OS — CID 18734022
N-[(6-fluoro-1-propylbenzimidazol-2-yl)methyl]-N-(2-methylpropyl)thiophene-3-carboxamide (PubChem CID 18734022) has the molecular formula C20H24FN3OS and a molecular weight of 373.50 g/mol. Its IUPAC name is N-[(6-fluoro-1-propylbenzimidazol-2-yl)methyl]-N-(2-methylpropyl)thiophene-3-carboxamide.
| Compound Name | N-[(6-fluoro-1-propylbenzimidazol-2-yl)methyl]-N-(2-methylpropyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 18734022 |
| Molecular Formula | C20H24FN3OS |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | N-[(6-fluoro-1-propylbenzimidazol-2-yl)methyl]-N-(2-methylpropyl)thiophene-3-carboxamide |
| SMILES | CCCn1c(CN(CC(C)C)C(=O)c2ccsc2)nc2ccc(F)cc21 |
| InChI | InChI=1S/C20H24FN3OS/c1-4-8-24-18-10-16(21)5-6-17(18)22-19(24)12-23(11-14(2)3)20(25)15-7-9-26-13-15/h5-7,9-10,13-14H,4,8,11-12H2,1-3H3 |
| InChIKey | YUTOQIYRWUKOMT-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |