C21H23ClFN3O — CID 18733828
N-[(6-chloro-1-ethylbenzimidazol-2-yl)methyl]-3-fluoro-N-(2-methylpropyl)benzamide (PubChem CID 18733828) has the molecular formula C21H23ClFN3O and a molecular weight of 387.89 g/mol. Its IUPAC name is N-[(6-chloro-1-ethylbenzimidazol-2-yl)methyl]-3-fluoro-N-(2-methylpropyl)benzamide.
| Compound Name | N-[(6-chloro-1-ethylbenzimidazol-2-yl)methyl]-3-fluoro-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 18733828 |
| Molecular Formula | C21H23ClFN3O |
| Molecular Weight | 387.89 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | N-[(6-chloro-1-ethylbenzimidazol-2-yl)methyl]-3-fluoro-N-(2-methylpropyl)benzamide |
| SMILES | CCn1c(CN(CC(C)C)C(=O)c2cccc(F)c2)nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C21H23ClFN3O/c1-4-26-19-11-16(22)8-9-18(19)24-20(26)13-25(12-14(2)3)21(27)15-6-5-7-17(23)10-15/h5-11,14H,4,12-13H2,1-3H3 |
| InChIKey | FYLZXLOCHGBTHK-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.89 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |