C21H23ClIN3O — CID 18733832
N-[(6-chloro-1-ethylbenzimidazol-2-yl)methyl]-3-iodo-4-methyl-N-propylbenzamide (PubChem CID 18733832) has the molecular formula C21H23ClIN3O and a molecular weight of 495.79 g/mol. Its IUPAC name is N-[(6-chloro-1-ethylbenzimidazol-2-yl)methyl]-3-iodo-4-methyl-N-propylbenzamide.
| Compound Name | N-[(6-chloro-1-ethylbenzimidazol-2-yl)methyl]-3-iodo-4-methyl-N-propylbenzamide |
|---|---|
| PubChem CID | 18733832 |
| Molecular Formula | C21H23ClIN3O |
| Molecular Weight | 495.79 g/mol |
| Exact Mass | 495.06 |
| IUPAC Name | N-[(6-chloro-1-ethylbenzimidazol-2-yl)methyl]-3-iodo-4-methyl-N-propylbenzamide |
| SMILES | CCCN(Cc1nc2ccc(Cl)cc2n1CC)C(=O)c1ccc(C)c(I)c1 |
| InChI | InChI=1S/C21H23ClIN3O/c1-4-10-25(21(27)15-7-6-14(3)17(23)11-15)13-20-24-18-9-8-16(22)12-19(18)26(20)5-2/h6-9,11-12H,4-5,10,13H2,1-3H3 |
| InChIKey | BKIARQYRJPOKES-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.79 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|