C24H25ClF3N3O — CID 18733709
N-[(6-chloro-1-cyclopentylbenzimidazol-2-yl)methyl]-2,3,6-trifluoro-N-(2-methylpropyl)benzamide (PubChem CID 18733709) has the molecular formula C24H25ClF3N3O and a molecular weight of 463.93 g/mol. Its IUPAC name is N-[(6-chloro-1-cyclopentylbenzimidazol-2-yl)methyl]-2,3,6-trifluoro-N-(2-methylpropyl)benzamide.
| Compound Name | N-[(6-chloro-1-cyclopentylbenzimidazol-2-yl)methyl]-2,3,6-trifluoro-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 18733709 |
| Molecular Formula | C24H25ClF3N3O |
| Molecular Weight | 463.93 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | N-[(6-chloro-1-cyclopentylbenzimidazol-2-yl)methyl]-2,3,6-trifluoro-N-(2-methylpropyl)benzamide |
| SMILES | CC(C)CN(Cc1nc2ccc(Cl)cc2n1C1CCCC1)C(=O)c1c(F)ccc(F)c1F |
| InChI | InChI=1S/C24H25ClF3N3O/c1-14(2)12-30(24(32)22-17(26)8-9-18(27)23(22)28)13-21-29-19-10-7-15(25)11-20(19)31(21)16-5-3-4-6-16/h7-11,14,16H,3-6,12-13H2,1-2H3 |
| InChIKey | OMJSEAQFGBOTJC-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.93 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|