C19H31NO2 — CID 18735697
N-(2-butoxy-3-propylphenyl)-3,3-dimethylbutanamide (PubChem CID 18735697) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is N-(2-butoxy-3-propylphenyl)-3,3-dimethylbutanamide.
| Compound Name | N-(2-butoxy-3-propylphenyl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 18735697 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | N-(2-butoxy-3-propylphenyl)-3,3-dimethylbutanamide |
| SMILES | CCCCOc1c(CCC)cccc1NC(=O)CC(C)(C)C |
| InChI | InChI=1S/C19H31NO2/c1-6-8-13-22-18-15(10-7-2)11-9-12-16(18)20-17(21)14-19(3,4)5/h9,11-12H,6-8,10,13-14H2,1-5H3,(H,20,21) |
| InChIKey | PWFGGLSRCJKONW-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|