C18H29NO2 — CID 18736088
N-butyl-N-(3,3-dimethylbutyl)-4-methoxybenzamide (PubChem CID 18736088) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is N-butyl-N-(3,3-dimethylbutyl)-4-methoxybenzamide.
| Compound Name | N-butyl-N-(3,3-dimethylbutyl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 18736088 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | N-butyl-N-(3,3-dimethylbutyl)-4-methoxybenzamide |
| SMILES | CCCCN(CCC(C)(C)C)C(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H29NO2/c1-6-7-13-19(14-12-18(2,3)4)17(20)15-8-10-16(21-5)11-9-15/h8-11H,6-7,12-14H2,1-5H3 |
| InChIKey | PDHRTFYSNPXPJO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |