C22H29N3O2S — CID 18738387
1-[[5-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]thiophen-2-yl]methyl]piperidin-2-one (PubChem CID 18738387) has the molecular formula C22H29N3O2S and a molecular weight of 399.56 g/mol. Its IUPAC name is 1-[[5-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]thiophen-2-yl]methyl]piperidin-2-one.
| Compound Name | 1-[[5-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]thiophen-2-yl]methyl]piperidin-2-one |
|---|---|
| PubChem CID | 18738387 |
| Molecular Formula | C22H29N3O2S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 1-[[5-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]thiophen-2-yl]methyl]piperidin-2-one |
| SMILES | COc1ccccc1N1CCN(Cc2ccc(CN3CCCCC3=O)s2)CC1 |
| InChI | InChI=1S/C22H29N3O2S/c1-27-21-7-3-2-6-20(21)24-14-12-23(13-15-24)16-18-9-10-19(28-18)17-25-11-5-4-8-22(25)26/h2-3,6-7,9-10H,4-5,8,11-17H2,1H3 |
| InChIKey | BTAVBIPIYWDCNO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |