C33H22F12N2O4 — CID 18739359
N-[5-[2-(3-acetamido-4-hydroxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]-4-[4-methyl-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)benzamide (PubChem CID 18739359) has the molecular formula C33H22F12N2O4 and a molecular weight of 738.52 g/mol. Its IUPAC name is N-[5-[2-(3-acetamido-4-hydroxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]-4-[4-methyl-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[5-[2-(3-acetamido-4-hydroxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]-4-[4-methyl-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 18739359 |
| Molecular Formula | C33H22F12N2O4 |
| Molecular Weight | 738.52 g/mol |
| Exact Mass | 738.14 |
| IUPAC Name | N-[5-[2-(3-acetamido-4-hydroxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]-4-[4-methyl-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)benzamide |
| SMILES | CC(=O)Nc1cc(C(c2ccc(O)c(NC(=O)c3ccc(-c4ccc(C)cc4C(F)(F)F)c(C(F)(F)F)c3)c2)(C(F)(F)F)C(F)(F)F)ccc1O |
| InChI | InChI=1S/C33H22F12N2O4/c1-15-3-7-20(22(11-15)30(34,35)36)21-8-4-17(12-23(21)31(37,38)39)28(51)47-25-14-19(6-10-27(25)50)29(32(40,41)42,33(43,44)45)18-5-9-26(49)24(13-18)46-16(2)48/h3-14,49-50H,1-2H3,(H,46,48)(H,47,51) |
| InChIKey | VGCTVQPNIVFAKA-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.52 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|