C10H13N3 — CID 18740830
1,2,7-trimethyl-4H-pyrido[2,3-d]pyrimidine (PubChem CID 18740830) has the molecular formula C10H13N3 and a molecular weight of 175.23 g/mol. Its IUPAC name is 1,2,7-trimethyl-4H-pyrido[2,3-d]pyrimidine.
| Compound Name | 1,2,7-trimethyl-4H-pyrido[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 18740830 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 1,2,7-trimethyl-4H-pyrido[2,3-d]pyrimidine |
| SMILES | CC1=NCc2ccc(C)nc2N1C |
| InChI | InChI=1S/C10H13N3/c1-7-4-5-9-6-11-8(2)13(3)10(9)12-7/h4-5H,6H2,1-3H3 |
| InChIKey | MJHGBESBRJGIRZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |