C21H22ClN5O4 — CID 18741268
2-[6-chloro-3-[2-(1-oxidopyridin-1-ium-2-yl)ethylamino]-2-oxopyrazin-1-yl]-N-(2-hydroxy-1-phenylethyl)acetamide (PubChem CID 18741268) has the molecular formula C21H22ClN5O4 and a molecular weight of 443.89 g/mol. Its IUPAC name is 2-[6-chloro-3-[2-(1-oxidopyridin-1-ium-2-yl)ethylamino]-2-oxopyrazin-1-yl]-N-(2-hydroxy-1-phenylethyl)acetamide.
| Compound Name | 2-[6-chloro-3-[2-(1-oxidopyridin-1-ium-2-yl)ethylamino]-2-oxopyrazin-1-yl]-N-(2-hydroxy-1-phenylethyl)acetamide |
|---|---|
| PubChem CID | 18741268 |
| Molecular Formula | C21H22ClN5O4 |
| Molecular Weight | 443.89 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 2-[6-chloro-3-[2-(1-oxidopyridin-1-ium-2-yl)ethylamino]-2-oxopyrazin-1-yl]-N-(2-hydroxy-1-phenylethyl)acetamide |
| SMILES | O=C(Cn1c(Cl)cnc(NCCc2cccc[n+]2[O-])c1=O)NC(CO)c1ccccc1 |
| InChI | InChI=1S/C21H22ClN5O4/c22-18-12-24-20(23-10-9-16-8-4-5-11-27(16)31)21(30)26(18)13-19(29)25-17(14-28)15-6-2-1-3-7-15/h1-8,11-12,17,28H,9-10,13-14H2,(H,23,24)(H,25,29) |
| InChIKey | SLGHVPZSPQXVFS-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.89 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|