C16H15ClN3O2+ — CID 58024052
1-chloro-N-[(1S)-2-hydroxy-1-phenylethyl]-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide (PubChem CID 58024052) has the molecular formula C16H15ClN3O2+ and a molecular weight of 316.77 g/mol. Its IUPAC name is 1-chloro-N-[(1S)-2-hydroxy-1-phenylethyl]-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide.
| Compound Name | 1-chloro-N-[(1S)-2-hydroxy-1-phenylethyl]-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide |
|---|---|
| PubChem CID | 58024052 |
| Molecular Formula | C16H15ClN3O2+ |
| Molecular Weight | 316.77 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 1-chloro-N-[(1S)-2-hydroxy-1-phenylethyl]-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide |
| SMILES | O=C(N[C@H](CO)c1ccccc1)c1[nH]c(Cl)c2cccc[n+]12 |
| InChI | InChI=1S/C16H14ClN3O2/c17-14-13-8-4-5-9-20(13)15(19-14)16(22)18-12(10-21)11-6-2-1-3-7-11/h1-9,12,21H,10H2,(H,18,22)/p+1/t12-/m1/s1 |
| InChIKey | DXQUCSBHSISFAP-GFCCVEGCSA-O |
| XLogP | 1.87 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.77 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|