C22H19FN3O2+ — CID 58023233
1-(4-fluorophenyl)-N-[(1R)-2-hydroxy-1-phenylethyl]-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide (PubChem CID 58023233) has the molecular formula C22H19FN3O2+ and a molecular weight of 376.41 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[(1R)-2-hydroxy-1-phenylethyl]-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-[(1R)-2-hydroxy-1-phenylethyl]-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide |
|---|---|
| PubChem CID | 58023233 |
| Molecular Formula | C22H19FN3O2+ |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[(1R)-2-hydroxy-1-phenylethyl]-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide |
| SMILES | O=C(N[C@@H](CO)c1ccccc1)c1[nH]c(-c2ccc(F)cc2)c2cccc[n+]12 |
| InChI | InChI=1S/C22H18FN3O2/c23-17-11-9-16(10-12-17)20-19-8-4-5-13-26(19)21(25-20)22(28)24-18(14-27)15-6-2-1-3-7-15/h1-13,18,27H,14H2,(H,24,28)/p+1/t18-/m0/s1 |
| InChIKey | ZROYMZAUIWTNBR-SFHVURJKSA-O |
| XLogP | 3.02 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|