C21H22N3O5+ — CID 58024075
1-(1,3-benzodioxol-5-yl)-N-[4-(hydroxymethyl)oxan-4-yl]-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide (PubChem CID 58024075) has the molecular formula C21H22N3O5+ and a molecular weight of 396.42 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N-[4-(hydroxymethyl)oxan-4-yl]-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N-[4-(hydroxymethyl)oxan-4-yl]-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide |
|---|---|
| PubChem CID | 58024075 |
| Molecular Formula | C21H22N3O5+ |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N-[4-(hydroxymethyl)oxan-4-yl]-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide |
| SMILES | O=C(NC1(CO)CCOCC1)c1[nH]c(-c2ccc3c(c2)OCO3)c2cccc[n+]12 |
| InChI | InChI=1S/C21H21N3O5/c25-12-21(6-9-27-10-7-21)23-20(26)19-22-18(15-3-1-2-8-24(15)19)14-4-5-16-17(11-14)29-13-28-16/h1-5,8,11,25H,6-7,9-10,12-13H2,(H,23,26)/p+1 |
| InChIKey | BCRKTVQFQVZGMX-UHFFFAOYSA-O |
| XLogP | 1.42 |
| TPSA | 96.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|