C19H23N4O4+ — CID 58023522
1-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[4-(hydroxymethyl)oxan-4-yl]-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide (PubChem CID 58023522) has the molecular formula C19H23N4O4+ and a molecular weight of 371.42 g/mol. Its IUPAC name is 1-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[4-(hydroxymethyl)oxan-4-yl]-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide.
| Compound Name | 1-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[4-(hydroxymethyl)oxan-4-yl]-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide |
|---|---|
| PubChem CID | 58023522 |
| Molecular Formula | C19H23N4O4+ |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 1-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[4-(hydroxymethyl)oxan-4-yl]-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide |
| SMILES | Cc1noc(C)c1-c1[nH]c(C(=O)NC2(CO)CCOCC2)[n+]2ccccc12 |
| InChI | InChI=1S/C19H22N4O4/c1-12-15(13(2)27-22-12)16-14-5-3-4-8-23(14)17(20-16)18(25)21-19(11-24)6-9-26-10-7-19/h3-5,8,24H,6-7,9-11H2,1-2H3,(H,21,25)/p+1 |
| InChIKey | QCXCKRXBUDLWQF-UHFFFAOYSA-O |
| XLogP | 1.30 |
| TPSA | 104.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|