C21H43N9O6 — CID 18741538
6-amino-2-[[2-[[6-amino-2-[(2-amino-3-hydroxypropanoyl)amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoic acid (PubChem CID 18741538) has the molecular formula C21H43N9O6 and a molecular weight of 517.63 g/mol. Its IUPAC name is 6-amino-2-[[2-[[6-amino-2-[(2-amino-3-hydroxypropanoyl)amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[6-amino-2-[(2-amino-3-hydroxypropanoyl)amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18741538 |
| Molecular Formula | C21H43N9O6 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.33 |
| IUPAC Name | 6-amino-2-[[2-[[6-amino-2-[(2-amino-3-hydroxypropanoyl)amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(CCCN=C(N)N)NC(=O)C(CCCCN)NC(=O)C(N)CO)C(=O)O |
| InChI | InChI=1S/C21H43N9O6/c22-9-3-1-6-14(28-17(32)13(24)12-31)18(33)29-15(8-5-11-27-21(25)26)19(34)30-16(20(35)36)7-2-4-10-23/h13-16,31H,1-12,22-24H2,(H,28,32)(H,29,33)(H,30,34)(H,35,36)(H4,25,26,27) |
| InChIKey | HHURYSYNGOQCTH-UHFFFAOYSA-N |
| XLogP | -3.84 |
| TPSA | 287.29 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | -3.84 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|