C18H36N8O6S — CID 18741531
2-[[2-[[6-amino-2-[(2-amino-3-hydroxypropanoyl)amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 18741531) has the molecular formula C18H36N8O6S and a molecular weight of 492.60 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[(2-amino-3-hydroxypropanoyl)amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[2-[[6-amino-2-[(2-amino-3-hydroxypropanoyl)amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 18741531 |
| Molecular Formula | C18H36N8O6S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | 2-[[2-[[6-amino-2-[(2-amino-3-hydroxypropanoyl)amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | NCCCCC(NC(=O)C(N)CO)C(=O)NC(CCCN=C(N)N)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C18H36N8O6S/c19-6-2-1-4-11(24-14(28)10(20)8-27)15(29)25-12(5-3-7-23-18(21)22)16(30)26-13(9-33)17(31)32/h10-13,27,33H,1-9,19-20H2,(H,24,28)(H,25,29)(H,26,30)(H,31,32)(H4,21,22,23) |
| InChIKey | UVAUWBCFWQMONE-UHFFFAOYSA-N |
| XLogP | -4.04 |
| TPSA | 261.27 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | -4.04 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|