C18H31N9O6 — CID 18748433
2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18748433) has the molecular formula C18H31N9O6 and a molecular weight of 469.50 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18748433 |
| Molecular Formula | C18H31N9O6 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC(O)C(N)C(=O)NC(Cc1cnc[nH]1)C(=O)NCC(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C18H31N9O6/c1-9(28)14(19)16(31)27-12(5-10-6-22-8-25-10)15(30)24-7-13(29)26-11(17(32)33)3-2-4-23-18(20)21/h6,8-9,11-12,14,28H,2-5,7,19H2,1H3,(H,22,25)(H,24,30)(H,26,29)(H,27,31)(H,32,33)(H4,20,21,23) |
| InChIKey | LPJUUXJXQKCDQX-UHFFFAOYSA-N |
| XLogP | -4.12 |
| TPSA | 263.93 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | -4.12 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|