C15H12Br2F3N3O — CID 18752001
1-(2,5-dibromophenyl)-1-methyl-2-[3-(trifluoromethoxy)phenyl]guanidine (PubChem CID 18752001) has the molecular formula C15H12Br2F3N3O and a molecular weight of 467.08 g/mol. Its IUPAC name is 1-(2,5-dibromophenyl)-1-methyl-2-[3-(trifluoromethoxy)phenyl]guanidine.
| Compound Name | 1-(2,5-dibromophenyl)-1-methyl-2-[3-(trifluoromethoxy)phenyl]guanidine |
|---|---|
| PubChem CID | 18752001 |
| Molecular Formula | C15H12Br2F3N3O |
| Molecular Weight | 467.08 g/mol |
| Exact Mass | 464.93 |
| IUPAC Name | 1-(2,5-dibromophenyl)-1-methyl-2-[3-(trifluoromethoxy)phenyl]guanidine |
| SMILES | CN(/C(N)=N/c1cccc(OC(F)(F)F)c1)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C15H12Br2F3N3O/c1-23(13-7-9(16)5-6-12(13)17)14(21)22-10-3-2-4-11(8-10)24-15(18,19)20/h2-8H,1H3,(H2,21,22) |
| InChIKey | ZXFOTGIUXOOMBR-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.08 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|