C16H17ClIN3 — CID 18752114
1-(2-chloro-5-ethylphenyl)-2-(3-iodophenyl)-1-methylguanidine (PubChem CID 18752114) has the molecular formula C16H17ClIN3 and a molecular weight of 413.69 g/mol. Its IUPAC name is 1-(2-chloro-5-ethylphenyl)-2-(3-iodophenyl)-1-methylguanidine.
| Compound Name | 1-(2-chloro-5-ethylphenyl)-2-(3-iodophenyl)-1-methylguanidine |
|---|---|
| PubChem CID | 18752114 |
| Molecular Formula | C16H17ClIN3 |
| Molecular Weight | 413.69 g/mol |
| Exact Mass | 413.02 |
| IUPAC Name | 1-(2-chloro-5-ethylphenyl)-2-(3-iodophenyl)-1-methylguanidine |
| SMILES | CCc1ccc(Cl)c(N(C)/C(N)=N/c2cccc(I)c2)c1 |
| InChI | InChI=1S/C16H17ClIN3/c1-3-11-7-8-14(17)15(9-11)21(2)16(19)20-13-6-4-5-12(18)10-13/h4-10H,3H2,1-2H3,(H2,19,20) |
| InChIKey | GEPMFUXMINZFQF-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.69 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|